Autophagy-related Compounds: Small Molecules and Peptides
51 results for "Autophagy-related Compounds Small Molecules and Peptides" in Products
51 results for "Autophagy-related Compounds Small Molecules and Peptides" in Products
Autophagy-related Compounds: Small Molecules and Peptides
| Alternate Names: | Compound C,BML-275 |
| Chemical Name: | 6-[4-[2-(1-Piperidinyl)ethoxy]phenyl]-3-(4-pyridinyl)-pyrazolo[1,5-a]pyrimidine dihydrochloride |
| Purity: | ≥98% (HPLC) |
| Chemical Name: | 2-(4-Morpholinyl)-8-phenyl-4H-1-benzopyran-4-one hydrochloride |
| Purity: | ≥99% (HPLC) |
| Chemical Name: | (11β,16α)-9-Fluoro-11,17,21-trihydroxy-16-methyl-pregna-1,4-diene-3,20-dione |
| Purity: | ≥98% (HPLC) |
| Chemical Name: | (3S,6R,7E,9R,10R,12R,14S,15E,17E,19E,21S,23S,26R,27R,34aS)-9,10,12,13,14,21,22,23,24,25,26,27,32,33,34,34a-Hexadecahydro-9,27-dihydroxy-3-[(1R)-2-[(1S,3R,4R)-4-hydroxy-3-methoxycyclohexyl]-1-methylethyl]-10,21-dimethoxy-6,8,12,14,20,26-hexamethyl-23,27-epoxy-3H-pyrido[2,1-c][1,4]oxaazacyclohentriacontine-1,5,11,28,29(4H,6H,31H)-pentone |
| Purity: | ≥98% (HPLC) |
| Chemical Name: | α-[3-[[2-(3,4-Dimethoxyphenyl)ethyl]methylamino]propyl]-3,4-dimethoxy-α-(1-methylethyl)benzeneacetonitrile hydrochloride |
| Purity: | ≥98% (HPLC) |
| Chemical Name: | 1-[4-[4-(1-Oxopropyl)-1-piperazinyl]-3-(trifluoromethyl)phenyl]-9-(3-quinolinyl)-benzo[h]-1,6-naphthyridin-2(1H)-one |
| Purity: | ≥98% (HPLC) |
| Alternate Names: | Paclitaxel |
| Chemical Name: | [2aR-[2aα,4β,4aβ,6α,9α(αR*,βS*),11α,12α,12aα,12bα]]-β-(Benzoylamino)-α-hydroxy-6,12b-bis(acetyloxy)-12-(benzoyloxy)-2a,3,4,4a,5,6,9,10,11,12,12,12b-dodecahydro-4,11-dihydroxy-4a,8,13,13-tetramethyl-5-oxo-7,11-methano-1H-cyclodeca[3,4]benz[1,2-b]oxet-9-yl ester benzenepropanoic acid |
| Purity: | ≥98% (HPLC) |
| Chemical Name: | (3S,3aR,4S,6S,6AR,7S,8S,9bS)-6-(Acetyloxy)-2,3,3a,4,5,6,6a,7,8,9b-decahydro-3,3a-dihydroxy-3,6,9-trimethyl-8-[[(2Z)-2-methyl-1-oxo-2-butenyl]oxy]-2-oxo-4-(1-oxobutoxy)azuleno[4,5-b]furan-7-yl octanoate |
| Purity: | ≥97% (HPLC) |
| Alternate Names: | VPA,Sodium Valproate |
| Chemical Name: | Sodium 2-propylpentanoate |
| Chemical Name: | N4-(7-Chloro-4-quinolinyl)-N1,N1-dimethyl-1,4-pentanediamine diphosphate salt |
| Purity: | ≥98% (HPLC) |
| Chemical Name: | 6,7-Dihydro-4-hydroxy-3-(2'-hydroxy[1,1'-biphenyl]-4-yl)-6-oxo-thieno[2,3-b]pyridine-5-carbonitrile |
| Purity: | ≥98% (HPLC) |
| Chemical Name: | N,N-Dimethylimidodicarbonimidic diamide hydrochloride |
| Alternate Names: | SL-2052 |
| Chemical Name: | (1S,6bR,9aS,11R,11bR) 11-(Acetyloxy)-1,6b,7,8,9a,10,11,11b-octahydro-1-(methoxymethyl)-9a,11b-dimethyl-3H-furo[4,3,2-de]indeno[4,5,-h]-2-h]-2-benzopyran-3,6,9-trione |
| Purity: | ≥98% (HPLC) |
| Alternate Names: | NSC 362856,CCRG 81045 |
| Chemical Name: | 3,4-Dihydro-3-methyl-4-oxoimidazo[5,1-d]-1,2,3,5-tetrazine-8-carboxamide |
| Purity: | ≥98% (HPLC) |
| Chemical Name: | Tunicamycin from Streptomyces sp. |
| Purity: | ≥98% (HPLC) |
| Chemical Name: | 6-Bromo-N-2-propenyl-4-quinazolinamine |
| Purity: | ≥98% (HPLC) |
| Chemical Name: | [5-(2-Thienylcarbonyl)-1H-benzimidazol-2-yl]carbamic acid methyl ester |
| Purity: | ≥95% (HPLC) |
| Alternate Names: | RAD001 |
| Chemical Name: | 42-O-(2-Hydroxyethyl)rapamycin |
| Purity: | ≥98% (HPLC) |
| Alternate Names: | Gö 6850,Bisindolylmaleimide I |
| Chemical Name: | 2-[1-(3-Dimethylaminopropyl)indol-3-yl]-3-(indol-3-yl) maleimide |
| Purity: | ≥98% (HPLC) |
| Chemical Name: | 1,4-Dihydro-2,6-dimethyl-4-(3-nitrophenyl)-3,5-pyridinedicarboxylic acid 2-methyloxyethyl 1-methylethyl ester |
| Purity: | ≥98% (HPLC) |
| Chemical Name: | 4,4',4'',4'''-[Carbonylbis(imino-5,1,3-benzenetriyl-bis(carbonylimino))]tetrakis-1,3-benzenedisulfonic acid, octasodium salt |
| Purity: | ≥90% (HPLC) |
| Chemical Name: | 1,4-Dihydro-2,6-dimethyl-5-nitro-4-[2-(trifluoromethyl)phenyl]-3-pyridinecarboxylic acid, methyl ester |
| Purity: | ≥98% (HPLC) |
| Chemical Name: | 2-[[4-[(7-Chloro-4-quinolinyl)amino]pentyl]ethylamino]ethanol sulfate |
| Purity: | ≥98% (HPLC) |
| Chemical Name: | 5-(3-Dimethylaminopropyl)-10,11-dihydro-5H-dibenz[b,f]azepine hydrochloride |
| Purity: | ≥98% (HPLC) |