29 results for "DNA, RNA and Protein Synthesis Compounds" in Products
DNA, RNA and Protein Synthesis Compounds Products
RNA, DNA and protein synthesis are fundamental processes necessary for all life.
RNA synthesis (transcription) begins by uncoiling a section of DNA that will be used as the template. RNA polymerase binds to a promoter sequence and initiates separation of the DNA double helix. Complementary ribonucleotides align and RNA polymerase catalyzes their polymerization. The newly synthesized RNA strand undergoes post-transcriptional processing before it leaves the nucleus.
Protein synthesis ...
| Alternate Names: | AM-2282 |
| Chemical Name: | [9S-(9α,10β,11β,13α)]-2,3,10,11,12,13-Hexahydro-10-methoxy-9-methyl-11-(methylamino)-9,13-epoxy-1H,9H-diindolo[1,2,3-gh:3',2',1'-lm]pyrrolo[3,4-j][1,7]benzodiazonin-1-one |
| Purity: | ≥98% (HPLC) |
| Chemical Name: | N-(2-((2S,4R)-2-(((S)-1-(2-Chloro-4-methoxyphenyl)ethyl)carbamoyl)-4-hydroxypyrrolidin-1-yl)-2-oxoethyl)-6-fluoroquinoline-2-carboxamide |
| Purity: | ≥98% (HPLC) |
| Alternate Names: | psoralen-triethylene glycol azide |
| Chemical Name: | 3-(13-Azido-5,8,11-trioxa-2-azatridec-1-yl)-2,5,9-trimethyl-7H-furo[3,2-g][1]benzopyran-7-one |
| Purity: | ≥98% (HPLC) |
| Chemical Name: | 5-ethynyl-1-((2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)pyrimidine-2,4(1H,3H)-dione |
| Purity: | ≥95% (HPLC) |
| Chemical Name: | (2-Aminopyridin-3-yl)(1H-imidazol-1-yl)methanone |
| Alternate Names: | CP 62993 |
| Chemical Name: | 13-[(2,6-Dideoxy-3-C-methyl-3-O-methyl-α-L-ribo-hexopyranosyl)oxy]-2-ethyl-3,4,10-trihydroxy-3,5,6,8,10,12,14-heptamethyl-11-[[3,4,6-trideoxy-3-(dimethylamino)-β-D-xylo-hexopyranosyl]oxy]-1-oxa-6-azacyclopentadecan-15-one |
| Purity: | ≥98% (HPLC) |
| Chemical Name: | 1-[(2,3-Dihydro-1,4-benzodioxin-2-yl)methyl]-3-hydroxythieno[3,2-d]pyrimidine-2,4(1H,3H)-dione |
| Purity: | ≥98% (HPLC) |
| Chemical Name: | 7-(4,7-Diazaspiro[2.5]oct-7-yl)-2-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-4H-pyrido[1,2-a]pyrimidin-4-one |
| Purity: | ≥98% (HPLC) |
| Chemical Name: | 2-[bis(2-Chloroethyl)amino]tetrahydro-2H-1,3,2-oxazaphosphorine 2-oxide |
| Purity: | ≥98% (HPLC) |
| Chemical Name: | 1-((2R,3R,4S,5R)-3,4-Dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-5-ethynylpyrimidine-2,4(1H,3H)-dione |
| Purity: | ≥98% (HPLC) |
| Chemical Name: | N1-(3-Chloro-1H-indol-7-yl)-1,4-benzenedisulfonamide |
| Purity: | ≥98% (HPLC) |
| Chemical Name: | 5-[(3R)-3-(Cyclopropylamino)-1-pyrrolidinyl]-N-(8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)-2-pyrazinecarboxamide |
| Purity: | ≥98% (HPLC) |
| Chemical Name: | 4-Thiouridine |
| Purity: | ≥98% (HPLC) |
| Alternate Names: | 1-Methyl-7-nitroisatoic anhydride |
| Chemical Name: | 1-Methyl-7-nitro-2H-3,1-benzoxazine-2,4(1H)-dione |
| Purity: | ≥95% (HPLC) |
| Chemical Name: | 2,6-Dichloro-7-(2-propyn-1-yl)-7H-purine |
| Purity: | ≥98% (HPLC) |
| Chemical Name: | 2-Chloro-N-(2-furanylmethyl)-7H-purin-6-amine |
| Purity: | ≥98% (HPLC) |
| Chemical Name: | 3-((1H-1,2,4-Triazol-1-yl)sulfonyl)pyridine |
| Purity: | ≥95% (HPLC) |
| Chemical Name: | (1-Methyl-2-nitro-1H-imidazol-5-yl)methyl N,N'-bis(2-bromoethyl)phosphorodiamidate |
| Applications: | AdAct |
| Purity: | ≥98% (HPLC) |
| Chemical Name: | 8-Chloro-N-[4-(trifluoromethoxy)phenyl]-2-quinolinamine |
| Purity: | ≥98% (HPLC) |
| Chemical Name: | 5-Bromo-2-deoxyuridine |
| Purity: | ≥98% (HPLC) |
| Chemical Name: | 2-(5-(4-Butylphenyl)furan-2-yl)-6-nitroquinoline-4-carboxylic acid |
| Applications: | CellVia |
| Purity: | ≥98% (HPLC) |
| Chemical Name: | N-[5-(Aminosulfonyl)-4-methyl-2-thiazolyl]-N-methyl-4-(2-pyridinyl)benzeneacetamide |
| Purity: | ≥98% (HPLC) |
| Chemical Name: | N-[(2S)-2-Hydroxy-1-oxopropyl]-L-phenylalanine |
| Purity: | ≥95% (HPLC) |
| Chemical Name: | N-(3-Chloro-4-fluorophenyl)-4-fluoro-3,5-dimethylbenzenesulfonamide |
| Purity: | ≥98% (HPLC) |
| Chemical Name: | 3-[[4-(Methylamino)-2-quinazolinyl]amino]benzoic acid |
| Purity: | ≥98% (HPLC) |
