17 results for "Molecular Glues" in Products
Molecular Glues Products
What are Molecular Glues?
Molecular Glues are small molecules that achieve targeted protein degradation by bringing about dimerization of target proteins with ubiquitin E3 ligases. This "degradation-by-dimerization" effect may occur either by direct binding interactions between an E3 ligase and the protein of interest, with the small molecule at the protein-protein interface. Alternatively binding of the molecular glue leads to allosteric modification of the E3 ligase protein ...
| Chemical Name: | N-(2-(2,6-Dioxopiperidin-3-yl)-1,3-dioxoisoindolin-5-yl)-2-(trifluoromethoxy)benzenesulfonamide |
| Purity: | ≥98% (HPLC) |
| Chemical Name: | 2-[[4-[(2,6-Dichlorophenyl)thio]-1,2-dihydro-2-oxo-6-(trifluoromethyl)-3-pyridinyl]carbonyl]-2,3-dihydro-1H-isoindole-4-carbonitrile |
| Purity: | ≥98% (HPLC) |
| Chemical Name: | N1-(3-Chloro-1H-indol-7-yl)-1,4-benzenedisulfonamide |
| Purity: | ≥98% (HPLC) |
| Chemical Name: | 3-(5-(Benzo[d]isoxazol-3-ylamino)-1-oxoisoindolin-2-yl)piperidine-2,6-dione |
| Purity: | ≥98% (HPLC) |
| Chemical Name: | 6,7-Dihydro-N-(5-methyl-2-thiazolyl)-5H-indeno[5,6-b]furan-3-acetamide |
| Purity: | ≥98% (HPLC) |
| Chemical Name: | rel-5-[[5-Chloro-2-[(3R,5S)-4,4-difluoro-3,5-dimethyl-1-piperidinyl]-4-pyrimidinyl]amino]-1,3-dihydro-3-(3-hydroxy-3-methylbutyl)-1-methyl-2H-benzimidazol-2-one |
| Purity: | ≥98% (HPLC) |
| Chemical Name: | N-(5-Chloro-2-pyridinyl)-2-(5H-1,2,4-triazino[5,6-b]indol-3-ylthio)acetamide |
| Purity: | ≥98% (HPLC) |
| Chemical Name: | tert-Butyl 2-((S)-4-(4-((4'-((S)-6-(2-(tert-butoxy)-2-oxoethyl)-2,3,9-trimethyl-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepin-4-yl)-[1,1'-biphenyl]-4-carboxamido)methyl)phenyl)-2,3,9-trimethyl-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepin-6-yl)acetate |
| Chemical Name: | 4-((4-(2-(tert-Butyl)-5,5-dimethyl-1,3-dioxan-2-yl)benzyl)amino)-3-methoxybenzoic acid |
| Purity: | ≥98% (HPLC) |
| Alternate Names: | Selective NTAQ1 degrader |
| Chemical Name: | 3-[6-[(Fluorosulfonyl)oxy]-1,3-dihydro-1-oxo-2H-isoindol-2-yl]-2,6-piperidinedione |
| Purity: | ≥95% (HPLC) |
| Chemical Name: | 1-[(3R)-3-[3-(4-Amino-1,3,5-triazin-2-yl)-5-chlorophenyl]-4-morpholinyl]-2-propen-1-one |
| Purity: | ≥98% (HPLC) |
| Chemical Name: | 1H-Indole-3-acetic acid |
| Purity: | ≥98% (HPLC) |
| Chemical Name: | α-[2-(2,4-Dimethylphenyl)-2-oxoethyl]-1H-indole-3-acetic acid |
| Purity: | ≥98% (HPLC) |
| Chemical Name: | 1-(4-Methoxyphenyl)-4-[4-(2-propyn-1-yl)-1-piperazinyl]-2-butene-1,4-dione |
| Purity: | ≥95% (HPLC) |
| Chemical Name: | 1-(4-Methoxyphenyl)-4-(1-piperazinyl)-2-butene-1,4-dione hydrochloride |
| Purity: | ≥95% (HPLC) |
| Chemical Name: | 2,3-Dihydro-2-[3-[cis-3-methyl-1-(4-methyl-4H-1,2,4-triazol-3-yl)cyclobutyl]phenyl]-6-[[(3S)-3-methyl-1-piperidinyl]methyl]-4-(trifluoromethyl)-1H-isoindol-1-one |
| Purity: | ≥98% (HPLC) |
| Chemical Name: | 3-Cyano-N-(3-cyano-4-methyl-1H-indol-7-yl)benzenesulfonamide |
| Purity: | ≥98% (HPLC) |