25 results for "DNA, RNA and Protein Synthesis Compounds Small Molecules and Peptides" in Products
DNA, RNA and Protein Synthesis Compounds: Small Molecules and Peptides
Non-selective protein kinase inhibitor
| Alternate Names: | AM-2282 |
| Chemical Name: | [9S-(9α,10β,11β,13α)]-2,3,10,11,12,13-Hexahydro-10-methoxy-9-methyl-11-(methylamino)-9,13-epoxy-1H,9H-diindolo[1,2,3-gh:3',2',1'-lm]pyrrolo[3,4-j][1,7]benzodiazonin-1-one |
| Purity: | ≥98% (HPLC) |
Alkylating agent; chemotherapeutic
| Chemical Name: | 2-[bis(2-Chloroethyl)amino]tetrahydro-2H-1,3,2-oxazaphosphorine 2-oxide |
| Purity: | ≥98% (HPLC) |
RNA conformation probe; reagent for COMRADES RNA platform
| Alternate Names: | psoralen-triethylene glycol azide |
| Chemical Name: | 3-(13-Azido-5,8,11-trioxa-2-azatridec-1-yl)-2,5,9-trimethyl-7H-furo[3,2-g][1]benzopyran-7-one |
| Purity: | ≥98% (HPLC) |
Synthetic thymidine analog; used for cell proliferation assays
| Chemical Name: | 5-Bromo-2-deoxyuridine |
| Purity: | ≥98% (HPLC) |
Thymidine analog for labeling DNA; can be linked to a fluorophore by click chemistry
| Chemical Name: | 5-ethynyl-1-((2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)pyrimidine-2,4(1H,3H)-dione |
| Purity: | ≥95% (HPLC) |
Antibiotic; inhibits 50S ribosomal subunit formation and elongation at transpeptidation
| Alternate Names: | CP 62993 |
| Chemical Name: | 13-[(2,6-Dideoxy-3-C-methyl-3-O-methyl-α-L-ribo-hexopyranosyl)oxy]-2-ethyl-3,4,10-trihydroxy-3,5,6,8,10,12,14-heptamethyl-11-[[3,4,6-trideoxy-3-(dimethylamino)-β-D-xylo-hexopyranosyl]oxy]-1-oxa-6-azacyclopentadecan-15-one |
| Purity: | ≥98% (HPLC) |
HIV RNA splicing modulator
| Chemical Name: | 8-Chloro-N-[4-(trifluoromethoxy)phenyl]-2-quinolinamine |
| Purity: | ≥98% (HPLC) |
Selective orthosteric inhibitor of the BRCA2-RAD51 interaction
| Chemical Name: | N-(2-((2S,4R)-2-(((S)-1-(2-Chloro-4-methoxyphenyl)ethyl)carbamoyl)-4-hydroxypyrrolidin-1-yl)-2-oxoethyl)-6-fluoroquinoline-2-carboxamide |
| Purity: | ≥98% (HPLC) |
Chemoproteomic reagent, clickable electrophilic purine for RNA binding profiling in live cells
| Chemical Name: | 2,6-Dichloro-7-(2-propyn-1-yl)-7H-purine |
| Purity: | ≥98% (HPLC) |
Photoreactive uridine analog for RNA sequencing
| Chemical Name: | 4-Thiouridine |
| Purity: | ≥98% (HPLC) |
Potent flap endonuclease 1 (FEN1) inhibitor; induces DNA damage response
| Chemical Name: | 1-[(2,3-Dihydro-1,4-benzodioxin-2-yl)methyl]-3-hydroxythieno[3,2-d]pyrimidine-2,4(1H,3H)-dione |
| Purity: | ≥98% (HPLC) |
Potent HTT pre-RNA splicing modulator
| Chemical Name: | 5-[(3R)-3-(Cyclopropylamino)-1-pyrrolidinyl]-N-(8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)-2-pyrazinecarboxamide |
| Purity: | ≥98% (HPLC) |
Hypoxia-activated DNA alkylating agent prodrug
| Chemical Name: | (1-Methyl-2-nitro-1H-imidazol-5-yl)methyl N,N'-bis(2-bromoethyl)phosphorodiamidate |
| Applications: | AdAct |
| Purity: | ≥98% (HPLC) |
Potent and selective DYRK1A inhibitor
| Chemical Name: | 7-Methoxy-1-methyl-9H-pyrido[3,4-b]indole |
| Purity: | ≥98% (HPLC) |
Selective SMN2 gene splicing modifier
| Chemical Name: | 7-(4,7-Diazaspiro[2.5]oct-7-yl)-2-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-4H-pyrido[1,2-a]pyrimidin-4-one |
| Purity: | ≥98% (HPLC) |
IKBKAP pre-mRNA splicing modulator
| Chemical Name: | 2-Chloro-N-(2-furanylmethyl)-7H-purin-6-amine |
| Purity: | ≥98% (HPLC) |
TERT activator
| Chemical Name: | N-(3-Chloro-4-fluorophenyl)-4-fluoro-3,5-dimethylbenzenesulfonamide |
| Purity: | ≥98% (HPLC) |
Molecular glue; pre-mRNA splicing modulator
| Chemical Name: | N1-(3-Chloro-1H-indol-7-yl)-1,4-benzenedisulfonamide |
| Purity: | ≥98% (HPLC) |
Auxin antagonist of TIR1/AFB receptors; also OsTIR1 inhibitor in auxin-inducible degron (AID) system
| Chemical Name: | α-[2-(2,4-Dimethylphenyl)-2-oxoethyl]-1H-indole-3-acetic acid |
| Purity: | ≥98% (HPLC) |
Modulator of alternative polyadenylation; inhibits rod photoreceptor gene expression via Nr2e3
| Chemical Name: | 6,7-Dimethoxy-2-[((4-phenyl-3,6-dihydropyridin-1(2H)-yl)methyl)]quinazolin-4(3H)-one |
| Purity: | ≥98% (HPLC) |
Metabolite generated by cytosol nonspecific dipeptidase (CNDP2) during intense exercise
| Chemical Name: | N-[(2S)-2-Hydroxy-1-oxopropyl]-L-phenylalanine |
| Purity: | ≥95% (HPLC) |
eIF4A inhibitor
| Chemical Name: | 2-(5-(4-Butylphenyl)furan-2-yl)-6-nitroquinoline-4-carboxylic acid |
| Applications: | CellVia |
| Purity: | ≥98% (HPLC) |
Binds to SARS-CoV-2 frameshifting element and reduces frameshifting efficiency
| Chemical Name: | 3-[[4-(Methylamino)-2-quinazolinyl]amino]benzoic acid |
| Purity: | ≥98% (HPLC) |
Potent and selective herpes simplex virus (HSV) helicase primase inhibitor
| Chemical Name: | N-[5-(Aminosulfonyl)-4-methyl-2-thiazolyl]-N-methyl-4-(2-pyridinyl)benzeneacetamide |
| Purity: | ≥98% (HPLC) |
Ligand for RNA aptamer AC17-4 activating gene expression in aptazime-based riboswitches
| Chemical Name: | N2,N4-Bis(4-fluorophenyl)-N6-(2-pyrimidinylmethyl)-1,3,5-triazine-2,4,6-triamine hemifumarate |
| Purity: | ≥98% (HPLC) |