DNA, RNA and Protein Synthesis Compounds Products
29 results for "DNA, RNA and Protein Synthesis Compounds" in Products
29 results for "DNA, RNA and Protein Synthesis Compounds" in Products
DNA, RNA and Protein Synthesis Compounds Products
Non-selective protein kinase inhibitor
| Alternate Names: | AM-2282 |
| Chemical Name: | [9S-(9α,10β,11β,13α)]-2,3,10,11,12,13-Hexahydro-10-methoxy-9-methyl-11-(methylamino)-9,13-epoxy-1H,9H-diindolo[1,2,3-gh:3',2',1'-lm]pyrrolo[3,4-j][1,7]benzodiazonin-1-one |
| Purity: | ≥98% (HPLC) |
Photoreactive uridine analog for RNA sequencing
| Chemical Name: | 4-Thiouridine |
| Purity: | ≥98% (HPLC) |
Uridine analog, used for labeling RNA synthesis
| Chemical Name: | 1-((2R,3R,4S,5R)-3,4-Dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-5-ethynylpyrimidine-2,4(1H,3H)-dione |
| Purity: | ≥98% (HPLC) |
Thymidine analog for labeling DNA; can be linked to a fluorophore by click chemistry
| Chemical Name: | 5-ethynyl-1-((2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)pyrimidine-2,4(1H,3H)-dione |
| Purity: | ≥95% (HPLC) |
Alkylating agent; chemotherapeutic
| Chemical Name: | 2-[bis(2-Chloroethyl)amino]tetrahydro-2H-1,3,2-oxazaphosphorine 2-oxide |
| Purity: | ≥98% (HPLC) |
Reagent for RNA SHAPE-MaP chemistry
| Alternate Names: | 1-Methyl-7-nitroisatoic anhydride |
| Chemical Name: | 1-Methyl-7-nitro-2H-3,1-benzoxazine-2,4(1H)-dione |
| Purity: | ≥95% (HPLC) |
Selective SMN2 gene splicing modifier
| Chemical Name: | 7-(4,7-Diazaspiro[2.5]oct-7-yl)-2-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-4H-pyrido[1,2-a]pyrimidin-4-one |
| Purity: | ≥98% (HPLC) |
Potent and selective DYRK1A inhibitor
| Chemical Name: | 7-Methoxy-1-methyl-9H-pyrido[3,4-b]indole |
| Purity: | ≥98% (HPLC) |
Reagent for RNA SHAPE-MaP experiments in vivo; cell permeable
| Chemical Name: | (2-Aminopyridin-3-yl)(1H-imidazol-1-yl)methanone |
Antibiotic; inhibits 50S ribosomal subunit formation and elongation at transpeptidation
| Alternate Names: | CP 62993 |
| Chemical Name: | 13-[(2,6-Dideoxy-3-C-methyl-3-O-methyl-α-L-ribo-hexopyranosyl)oxy]-2-ethyl-3,4,10-trihydroxy-3,5,6,8,10,12,14-heptamethyl-11-[[3,4,6-trideoxy-3-(dimethylamino)-β-D-xylo-hexopyranosyl]oxy]-1-oxa-6-azacyclopentadecan-15-one |
| Purity: | ≥98% (HPLC) |
RNA conformation probe; reagent for COMRADES RNA platform
| Alternate Names: | psoralen-triethylene glycol azide |
| Chemical Name: | 3-(13-Azido-5,8,11-trioxa-2-azatridec-1-yl)-2,5,9-trimethyl-7H-furo[3,2-g][1]benzopyran-7-one |
| Purity: | ≥98% (HPLC) |
IKBKAP pre-mRNA splicing modulator
| Chemical Name: | 2-Chloro-N-(2-furanylmethyl)-7H-purin-6-amine |
| Purity: | ≥98% (HPLC) |
Molecular glue; pre-mRNA splicing modulator
| Chemical Name: | N1-(3-Chloro-1H-indol-7-yl)-1,4-benzenedisulfonamide |
| Purity: | ≥98% (HPLC) |
Reagent for modifying RNA at 2'-OH position, for SHAPE-MAP experiments
| Chemical Name: | 3-((1H-1,2,4-Triazol-1-yl)sulfonyl)pyridine |
| Purity: | ≥95% (HPLC) |
Auxin antagonist of TIR1/AFB receptors; also OsTIR1 inhibitor in auxin-inducible degron (AID) system
| Chemical Name: | α-[2-(2,4-Dimethylphenyl)-2-oxoethyl]-1H-indole-3-acetic acid |
| Purity: | ≥98% (HPLC) |
Metabolite generated by cytosol nonspecific dipeptidase (CNDP2) during intense exercise
| Chemical Name: | N-[(2S)-2-Hydroxy-1-oxopropyl]-L-phenylalanine |
| Purity: | ≥95% (HPLC) |
Potent and selective herpes simplex virus (HSV) helicase primase inhibitor
| Chemical Name: | N-[5-(Aminosulfonyl)-4-methyl-2-thiazolyl]-N-methyl-4-(2-pyridinyl)benzeneacetamide |
| Purity: | ≥98% (HPLC) |
Chemoproteomic reagent, clickable electrophilic purine for RNA binding profiling in live cells
| Chemical Name: | 2,6-Dichloro-7-(2-propyn-1-yl)-7H-purine |
| Purity: | ≥98% (HPLC) |
Ligand for RNA aptamer AC17-4 activating gene expression in aptazime-based riboswitches
| Chemical Name: | N2,N4-Bis(4-fluorophenyl)-N6-(2-pyrimidinylmethyl)-1,3,5-triazine-2,4,6-triamine hemifumarate |
| Purity: | ≥98% (HPLC) |
Selective orthosteric inhibitor of the BRCA2-RAD51 interaction
| Chemical Name: | N-(2-((2S,4R)-2-(((S)-1-(2-Chloro-4-methoxyphenyl)ethyl)carbamoyl)-4-hydroxypyrrolidin-1-yl)-2-oxoethyl)-6-fluoroquinoline-2-carboxamide |
| Purity: | ≥98% (HPLC) |
Potent flap endonuclease 1 (FEN1) inhibitor; induces DNA damage response
| Chemical Name: | 1-[(2,3-Dihydro-1,4-benzodioxin-2-yl)methyl]-3-hydroxythieno[3,2-d]pyrimidine-2,4(1H,3H)-dione |
| Purity: | ≥98% (HPLC) |
HIV RNA splicing modulator
| Chemical Name: | 8-Chloro-N-[4-(trifluoromethoxy)phenyl]-2-quinolinamine |
| Purity: | ≥98% (HPLC) |
Potent HTT pre-RNA splicing modulator
| Chemical Name: | 5-[(3R)-3-(Cyclopropylamino)-1-pyrrolidinyl]-N-(8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)-2-pyrazinecarboxamide |
| Purity: | ≥98% (HPLC) |
Hypoxia-activated DNA alkylating agent prodrug
| Chemical Name: | (1-Methyl-2-nitro-1H-imidazol-5-yl)methyl N,N'-bis(2-bromoethyl)phosphorodiamidate |
| Applications: | AdAct |
| Purity: | ≥98% (HPLC) |
Binds to SARS-CoV-2 frameshifting element and reduces frameshifting efficiency
| Chemical Name: | 3-[[4-(Methylamino)-2-quinazolinyl]amino]benzoic acid |
| Purity: | ≥98% (HPLC) |