Autophagy-related Compounds Products
51 results for "Autophagy-related Compounds" in Products
51 results for "Autophagy-related Compounds" in Products
Autophagy-related Compounds Products
Potent AMPK inhibitor; also BMP type I receptor inhibitor
| Alternate Names: | Compound C,BML-275 |
| Chemical Name: | 6-[4-[2-(1-Piperidinyl)ethoxy]phenyl]-3-(4-pyridinyl)-pyrazolo[1,5-a]pyrimidine dihydrochloride |
| Purity: | ≥98% (HPLC) |
Prototypical PI 3-kinase inhibitor; also inhibits other kinases
| Chemical Name: | 2-(4-Morpholinyl)-8-phenyl-4H-1-benzopyran-4-one hydrochloride |
| Purity: | ≥99% (HPLC) |
Potent and selective mTOR inhibitor
| Chemical Name: | 1-[4-[4-(1-Oxopropyl)-1-piperazinyl]-3-(trifluoromethyl)phenyl]-9-(3-quinolinyl)-benzo[h]-1,6-naphthyridin-2(1H)-one |
| Purity: | ≥98% (HPLC) |
Potent, irreversible inhibitor of PI 3-kinase. Also inhibitor of PLK1
| Alternate Names: | SL-2052 |
| Chemical Name: | (1S,6bR,9aS,11R,11bR) 11-(Acetyloxy)-1,6b,7,8,9a,10,11,11b-octahydro-1-(methoxymethyl)-9a,11b-dimethyl-3H-furo[4,3,2-de]indeno[4,5,-h]-2-h]-2-benzopyran-3,6,9-trione |
| Purity: | ≥98% (HPLC) |
Anti-inflammatory glucocorticoid
| Chemical Name: | (11β,16α)-9-Fluoro-11,17,21-trihydroxy-16-methyl-pregna-1,4-diene-3,20-dione |
| Purity: | ≥98% (HPLC) |
Promotes assembly and inhibits disassembly of microtubules
| Alternate Names: | Paclitaxel |
| Chemical Name: | [2aR-[2aα,4β,4aβ,6α,9α(αR*,βS*),11α,12α,12aα,12bα]]-β-(Benzoylamino)-α-hydroxy-6,12b-bis(acetyloxy)-12-(benzoyloxy)-2a,3,4,4a,5,6,9,10,11,12,12,12b-dodecahydro-4,11-dihydroxy-4a,8,13,13-tetramethyl-5-oxo-7,11-methano-1H-cyclodeca[3,4]benz[1,2-b]oxet-9-yl ester benzenepropanoic acid |
| Purity: | ≥98% (HPLC) |
Antimalarial; inhibits apoptosis and autophagy
| Chemical Name: | N4-(7-Chloro-4-quinolinyl)-N1,N1-dimethyl-1,4-pentanediamine diphosphate salt |
| Purity: | ≥98% (HPLC) |
mTOR inhibitor; immunosuppressant
| Chemical Name: | (3S,6R,7E,9R,10R,12R,14S,15E,17E,19E,21S,23S,26R,27R,34aS)-9,10,12,13,14,21,22,23,24,25,26,27,32,33,34,34a-Hexadecahydro-9,27-dihydroxy-3-[(1R)-2-[(1S,3R,4R)-4-hydroxy-3-methoxycyclohexyl]-1-methylethyl]-10,21-dimethoxy-6,8,12,14,20,26-hexamethyl-23,27-epoxy-3H-pyrido[2,1-c][1,4]oxaazacyclohentriacontine-1,5,11,28,29(4H,6H,31H)-pentone |
| Purity: | ≥98% (HPLC) |
Histone deacetylase inhibitor
| Alternate Names: | VPA,Sodium Valproate |
| Chemical Name: | Sodium 2-propylpentanoate |
Selective and high affinity cathepsin D inhibitor
| Purity: | ≥95% (HPLC) |
Activator of LKB1/AMPK; antidiabetic agent
| Chemical Name: | N,N-Dimethylimidodicarbonimidic diamide hydrochloride |
H+-ATPase (vacuolar) inhibitor
| Alternate Names: | Folimycin |
| Chemical Name: | (3Z,5E,7R,8R,9S,10S,11R,13E,15E,17S,18R)-18-[(1S,2R,3S)-3-[(2R,4R,5S,6R)-4-[[4-O-(Aminocarbonyl)-2,6-dideoxy-β-D-arabino-hexopyranosyl]oxy]tetrahydro-2-hydroxy-5-methyl-6-(1E)-1-propenyl-2H-pyran-2-yl]-2-hydroxy-1-methylbutyl]-9-ethyl-8,10-dihydroxy-3,17-dimethoxy-5,7,11,13-tetramethyloxacyclooctadeca-3,5,13,15-tetraen-2-one |
| Purity: | ≥90% (HPLC) |
Potent inhibitor of SERCA ATPase
| Chemical Name: | (3S,3aR,4S,6S,6AR,7S,8S,9bS)-6-(Acetyloxy)-2,3,3a,4,5,6,6a,7,8,9b-decahydro-3,3a-dihydroxy-3,6,9-trimethyl-8-[[(2Z)-2-methyl-1-oxo-2-butenyl]oxy]-2-oxo-4-(1-oxobutoxy)azuleno[4,5-b]furan-7-yl octanoate |
| Purity: | ≥97% (HPLC) |
Antibiotic; GlcNAc phosphotransferase inhibitor
| Chemical Name: | Tunicamycin from Streptomyces sp. |
| Purity: | ≥98% (HPLC) |
Autophagy inhibitor; also TLR9 inhibitor
| Chemical Name: | 2-[[4-[(7-Chloro-4-quinolinyl)amino]pentyl]ethylamino]ethanol sulfate |
| Purity: | ≥98% (HPLC) |
Potent AMPK activator
| Chemical Name: | 6,7-Dihydro-4-hydroxy-3-(2'-hydroxy[1,1'-biphenyl]-4-yl)-6-oxo-thieno[2,3-b]pyridine-5-carbonitrile |
| Purity: | ≥98% (HPLC) |
HMG-CoA reductase inhibitor
| Chemical Name: | (1S,3R,7S,8S,8aR)-1,2,3,7,8,8a-Hexahydro-3,7-dimethyl-8-[2-[(2R,4R)-tetrahydro-4-hydroxy-6-oxo-2H-pyran-2-yl]ethyl]-1-naphthalenyly-2,2-dimethyl butanoate |
| Purity: | ≥98% (HPLC) |
Microtubule inhibitor
| Chemical Name: | [5-(2-Thienylcarbonyl)-1H-benzimidazol-2-yl]carbonic acid, methyl ester |
| Purity: | ≥95% (HPLC) |
mTOR inhibitor; Immunosuppressant
| Alternate Names: | RAD001 |
| Chemical Name: | 42-O-(2-Hydroxyethyl)rapamycin |
| Purity: | ≥98% (HPLC) |
p53 inhibitor. Also aryl hydrocarbon receptor agonist
| Chemical Name: | 1-(4-Methylphenyl)-2-(4,5,6,7-tetrahydro-2-imino-3(2H)-benzothiazolyl)ethanone hydrobromide |
Highly selective P2X1 antagonist
| Chemical Name: | 4,4',4'',4'''-[Carbonylbis(imino-5,1,3-benzenetriyl-bis(carbonylimino))]tetrakis-1,3-benzenedisulfonic acid, octasodium salt |
| Purity: | ≥90% (HPLC) |
Protein kinase C inhibitor
| Alternate Names: | Gö 6850,Bisindolylmaleimide I |
| Chemical Name: | 2-[1-(3-Dimethylaminopropyl)indol-3-yl]-3-(indol-3-yl) maleimide |
| Purity: | ≥98% (HPLC) |
Calcium ionophore
| Alternate Names: | Calcimycin |
| Chemical Name: | 5-(Methylamino)-2-[[2R,3R,6S,8S,9R,11R)-3,9,11-trimethyl-8-[(1S)-1-methyl-2-oxo-2-(1H-pyrrol-2-yl)-ethyl]-1,7-dioxaspiro[5.5]undec-2-yl]methyl]-4-benzoxazolecarboxylic acid |
| Purity: | ≥98% (HPLC) |
Class III PI 3-kinase inhibitor; also inhibits autophagy
| Alternate Names: | 3-MA |
| Chemical Name: | 3-Methyl-3H-purin-6-amine |
| Purity: | ≥98% (HPLC) |
Positive regulator of autophagy
| Chemical Name: | 6-Bromo-N-2-propenyl-4-quinazolinamine |
| Purity: | ≥98% (HPLC) |