51 results for "Autophagy-related Compounds" in Products
Autophagy-related Compounds Products
Autophagy is a process by which a cell breaks down macromolecules in response to starvation or stress signals. While it is closely linked with apoptosis, autophagy is primarily characterized as a catabolic mechanism by which cellular energy homeostasis is maintained, and by which cellular organelles and proteins are degraded.
Autophagy also occurs in response to similar stresses to those which induce apoptosis and several proapoptotic signals also induce autophagy - for example, ...
Potent AMPK inhibitor; also BMP type I receptor inhibitor
| Alternate Names: | Compound C,BML-275 |
| Chemical Name: | 6-[4-[2-(1-Piperidinyl)ethoxy]phenyl]-3-(4-pyridinyl)-pyrazolo[1,5-a]pyrimidine dihydrochloride |
| Purity: | ≥98% (HPLC) |
Anti-inflammatory glucocorticoid
| Chemical Name: | (11β,16α)-9-Fluoro-11,17,21-trihydroxy-16-methyl-pregna-1,4-diene-3,20-dione |
| Purity: | ≥98% (HPLC) |
Prototypical PI 3-kinase inhibitor; also inhibits other kinases
| Chemical Name: | 2-(4-Morpholinyl)-8-phenyl-4H-1-benzopyran-4-one hydrochloride |
| Purity: | ≥99% (HPLC) |
Potent inhibitor of SERCA ATPase
| Chemical Name: | (3S,3aR,4S,6S,6AR,7S,8S,9bS)-6-(Acetyloxy)-2,3,3a,4,5,6,6a,7,8,9b-decahydro-3,3a-dihydroxy-3,6,9-trimethyl-8-[[(2Z)-2-methyl-1-oxo-2-butenyl]oxy]-2-oxo-4-(1-oxobutoxy)azuleno[4,5-b]furan-7-yl octanoate |
| Purity: | ≥97% (HPLC) |
Selective and high affinity cathepsin D inhibitor
| Purity: | ≥95% (HPLC) |
mTOR inhibitor; immunosuppressant
| Chemical Name: | (3S,6R,7E,9R,10R,12R,14S,15E,17E,19E,21S,23S,26R,27R,34aS)-9,10,12,13,14,21,22,23,24,25,26,27,32,33,34,34a-Hexadecahydro-9,27-dihydroxy-3-[(1R)-2-[(1S,3R,4R)-4-hydroxy-3-methoxycyclohexyl]-1-methylethyl]-10,21-dimethoxy-6,8,12,14,20,26-hexamethyl-23,27-epoxy-3H-pyrido[2,1-c][1,4]oxaazacyclohentriacontine-1,5,11,28,29(4H,6H,31H)-pentone |
| Purity: | ≥98% (HPLC) |
Histone deacetylase inhibitor
| Alternate Names: | VPA,Sodium Valproate |
| Chemical Name: | Sodium 2-propylpentanoate |
Potent and selective mTOR inhibitor
| Chemical Name: | 1-[4-[4-(1-Oxopropyl)-1-piperazinyl]-3-(trifluoromethyl)phenyl]-9-(3-quinolinyl)-benzo[h]-1,6-naphthyridin-2(1H)-one |
| Purity: | ≥98% (HPLC) |
Activator of LKB1/AMPK; antidiabetic agent
| Chemical Name: | N,N-Dimethylimidodicarbonimidic diamide hydrochloride |
Promotes assembly and inhibits disassembly of microtubules
| Alternate Names: | Paclitaxel |
| Chemical Name: | [2aR-[2aα,4β,4aβ,6α,9α(αR*,βS*),11α,12α,12aα,12bα]]-β-(Benzoylamino)-α-hydroxy-6,12b-bis(acetyloxy)-12-(benzoyloxy)-2a,3,4,4a,5,6,9,10,11,12,12,12b-dodecahydro-4,11-dihydroxy-4a,8,13,13-tetramethyl-5-oxo-7,11-methano-1H-cyclodeca[3,4]benz[1,2-b]oxet-9-yl ester benzenepropanoic acid |
| Purity: | ≥98% (HPLC) |
Dexamethasone synthesized to Ancillary Material Grade
| Chemical Name: | (11β,16α)-9-Fluoro-11,17,21-trihydroxy-16-methylpregna-1,4-diene-3,20-dione |
| Purity: | ≥98% |
Potent AMPK activator
| Chemical Name: | 6,7-Dihydro-4-hydroxy-3-(2'-hydroxy[1,1'-biphenyl]-4-yl)-6-oxo-thieno[2,3-b]pyridine-5-carbonitrile |
| Purity: | ≥98% (HPLC) |
mTOR inhibitor; Immunosuppressant
| Alternate Names: | RAD001 |
| Chemical Name: | 42-O-(2-Hydroxyethyl)rapamycin |
| Purity: | ≥98% (HPLC) |
Potent, irreversible inhibitor of PI 3-kinase. Also inhibitor of PLK1
| Alternate Names: | SL-2052 |
| Chemical Name: | (1S,6bR,9aS,11R,11bR) 11-(Acetyloxy)-1,6b,7,8,9a,10,11,11b-octahydro-1-(methoxymethyl)-9a,11b-dimethyl-3H-furo[4,3,2-de]indeno[4,5,-h]-2-h]-2-benzopyran-3,6,9-trione |
| Purity: | ≥98% (HPLC) |
Highly selective P2X1 antagonist
| Chemical Name: | 4,4',4'',4'''-[Carbonylbis(imino-5,1,3-benzenetriyl-bis(carbonylimino))]tetrakis-1,3-benzenedisulfonic acid, octasodium salt |
| Purity: | ≥90% (HPLC) |
Antimalarial; inhibits apoptosis and autophagy
| Chemical Name: | N4-(7-Chloro-4-quinolinyl)-N1,N1-dimethyl-1,4-pentanediamine diphosphate salt |
| Purity: | ≥98% (HPLC) |
CaV1.x blocker
| Chemical Name: | α-[3-[[2-(3,4-Dimethoxyphenyl)ethyl]methylamino]propyl]-3,4-dimethoxy-α-(1-methylethyl)benzeneacetonitrile hydrochloride |
| Purity: | ≥98% (HPLC) |
Disrupts protein translocation to Golgi
| Chemical Name: | 1,6,7,8,9,11aβ,12,13,14,14aα-Decahydro-1β,13α-dihydroxy-6β-methyl-4H-cyclopent[f]oxacyclotridecin-4-one |
| Purity: | ≥98% (HPLC) |
Protein kinase C inhibitor
| Alternate Names: | Gö 6850,Bisindolylmaleimide I |
| Chemical Name: | 2-[1-(3-Dimethylaminopropyl)indol-3-yl]-3-(indol-3-yl) maleimide |
| Purity: | ≥98% (HPLC) |
Microtubule inhibitor
| Chemical Name: | [5-(2-Thienylcarbonyl)-1H-benzimidazol-2-yl]carbamic acid methyl ester |
| Purity: | ≥95% (HPLC) |
p53 inhibitor. Also aryl hydrocarbon receptor agonist
| Chemical Name: | 1-(4-Methylphenyl)-2-(4,5,6,7-tetrahydro-2-imino-3(2H)-benzothiazolyl)ethanone hydrobromide |
Autophagy inhibitor; also TLR9 inhibitor
| Chemical Name: | 2-[[4-[(7-Chloro-4-quinolinyl)amino]pentyl]ethylamino]ethanol sulfate |
| Purity: | ≥98% (HPLC) |
STAT3 inhibitor; also inhibits mTORC1 signaling
| Chemical Name: | 5-Chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide |
| Purity: | ≥98% (HPLC) |
Cathepsin inhibitor; interferes with autolysosomal digestion
| Chemical Name: | (2S,3S)-3-[[[(1S)-3-Methyl-1-[[(3-methylbutyl)amino]carbonyl]butyl]amino]carbonyl]-2-oxiranecarboxylic acid ethyl ester |
| Purity: | ≥98% (HPLC) |
H+-ATPase (vacuolar) inhibitor
| Alternate Names: | Folimycin |
| Chemical Name: | (3Z,5E,7R,8R,9S,10S,11R,13E,15E,17S,18R)-18-[(1S,2R,3S)-3-[(2R,4R,5S,6R)-4-[[4-O-(Aminocarbonyl)-2,6-dideoxy-β-D-arabino-hexopyranosyl]oxy]tetrahydro-2-hydroxy-5-methyl-6-(1E)-1-propenyl-2H-pyran-2-yl]-2-hydroxy-1-methylbutyl]-9-ethyl-8,10-dihydroxy-3,17-dimethoxy-5,7,11,13-tetramethyloxacyclooctadeca-3,5,13,15-tetraen-2-one |
| Purity: | ≥90% (HPLC) |