5 results for "Antimalarials" in Products
Antimalarials Products
Antimalarial; inhibits apoptosis and autophagy
| Chemical Name: | N4-(7-Chloro-4-quinolinyl)-N1,N1-dimethyl-1,4-pentanediamine diphosphate salt |
| Purity: | ≥98% (HPLC) |
Antimalarial; also inhibits neuroinflammation
| Chemical Name: | (3R,5aS,6R,8aS,9R,10S,12R,12aR)-Decahydro-10-methoxy-3,6,9-trimethyl-3,12-epoxy-12H-pyrano[4,3-j]-1,2-benzodioxepin |
| Purity: | ≥97% (HPLC) |
Pan-histone deacetylase inhibitor
| Chemical Name: | (2E)-N-Hydroxy-3-[4-[[[2-(2-methyl-1H-indol-3-yl)ethyl]amino]methyl]phenyl]-2-propenamide |
| Purity: | ≥98% (HPLC) |
Cx36 and Cx50 gap channel blocker; also antimalarial and antischistosomal
| Chemical Name: | (αS)-rel-α-(2R)-2-Piperidinyl-2,3-bis(trifluoromethyl-4-quinolinemethanol hydrochloride |
| Purity: | ≥98% (HPLC) |
Potent microsomal triglyceride transfer protein (MTP) inhibitor
| Chemical Name: | N-(2,2,2-Trifluoroethyl)-9-[4-[4-[[[4'-(trifluoromethyl)[1,1'-biphenyl]-2-yl]carbonyl]amino]-1-piperidinyl]butyl]-9H-fluorene-9-carboxamide methanesulfonate |
| Purity: | ≥98% (HPLC) |