47 results for "HCC1" in Products
HCC1 Products
HCC1 is encoded by this gene is an RNA binding protein and possible splicing factor. The encoded protein is found in the nucleus, where it colocalizes with core spliceosomal proteins. Studies of a mouse protein with high sequence similarity to this protein suggest that this protein may act as a transcriptional coactivator for JUN/AP-1 and estrogen receptors. Multiple transcript variants encoding different isoforms have been observed for this gene.
| Reactivity: | Human |
| Details: | Rabbit IgG Polyclonal |
| Applications: | IHC, WB, IP |
| Reactivity: | Human, Mouse, Rat |
| Details: | Rabbit IgG Polyclonal |
| Applications: | IHC, WB, ELISA, ICC/IF |
| Reactivity: | Human |
| Details: | Rabbit IgG Polyclonal |
| Applications: | IHC, WB, IP |
![Western Blot: HCC1 AntibodyBSA Free [NB200-333]](https://resources.bio-techne.com/images/products/HCC1-Antibody-Western-Blot-NB200-333-img0007.jpg "Western Blot: HCC1 AntibodyBSA Free [NB200-333]")
Conjugate
Catalog #
| Reactivity: | Human |
| Details: | Rabbit IgG Polyclonal |
| Applications: | IHC, WB, Mycoplasma, Simple Western |
![Immunohistochemistry-Paraffin: HCC1 Antibody [NBP1-88200]](https://resources.bio-techne.com/images/products/HCC1-Antibody-Immunohistochemistry-Paraffin-NBP1-88200-img0021.jpg "Immunohistochemistry-Paraffin: HCC1 Antibody [NBP1-88200]")
| Reactivity: | Human, Mouse |
| Details: | Mouse IgG2a Kappa Monoclonal Clone #4G8 |
| Applications: | IHC, WB, ELISA, ICC/IF |
![Western Blot: HCC1 Antibody (4G8) [H00009584-M01]](https://resources.bio-techne.com/images/products/HCC1-Antibody-4G8-Western-Blot-H00009584-M01-img0012.jpg "Western Blot: HCC1 Antibody (4G8) [H00009584-M01]")
| Applications: | WB, ELISA, MA, AP, PAGE |
![SDS-PAGE: Recombinant Human HCC1 GST (N-Term) Protein [H00009584-Q01]](https://resources.bio-techne.com/images/products/qc_test-H00009584-Q01-1.jpg "SDS-PAGE: Recombinant Human HCC1 GST (N-Term) Protein [H00009584-Q01]")
| Applications: | WB, ELISA, MA, AP |
| Reactivity: | Human |
| Details: | Rabbit IgG Polyclonal |
| Applications: | WB |
![Western Blot: HCC1 Antibody [H00009584-D01P]](https://resources.bio-techne.com/images/products/HCC1-Antibody-Western-Blot-H00009584-D01P-img0003.jpg "Western Blot: HCC1 Antibody [H00009584-D01P]")
![Western Blot: HCC1 Overexpression Lysate [NBL1-15210]](https://resources.bio-techne.com/images/products/HCC1-Overexpression-Lysate-Adult-Normal-Western-Blot-NBL1-15210-img0002.jpg "Western Blot: HCC1 Overexpression Lysate [NBL1-15210]")
| Reactivity: | Human |
| Details: | Rabbit IgG Polyclonal |
| Applications: | IHC, WB, IP |
Conjugate
Catalog #
Forumulation
Catalog #
| Reactivity: | Human |
| Details: | Rabbit IgG Polyclonal |
| Applications: | IHC, WB, IP |
Conjugate
Catalog #
Forumulation
Catalog #
| Reactivity: | Human |
| Details: | Rabbit IgG Polyclonal |
| Applications: | IHC, WB, IP |
![HCC1 Antibody [CoraFluor™ 1]](https://resources.bio-techne.com/images/products/nb200-333cl1_rabbit-hcc1-pab-corafluor-1-10920251141296.png "Product Feature: CoraFluor Probes for TR-FRET")
Conjugate
Catalog #
Forumulation
Catalog #
| Reactivity: | Human |
| Details: | Rabbit IgG Polyclonal |
| Applications: | IHC, WB, IP |
| Reactivity: | Human, Mouse |
| Details: | Rabbit IgG Polyclonal |
| Applications: | WB |
![Western Blot: HCC1 Antibody [NBP2-16785]](https://resources.bio-techne.com/images/products/HCC1-Antibody-Western-Blot-NBP2-16785-img0002.jpg "Western Blot: HCC1 Antibody [NBP2-16785]")
![Western Blot: HCC1 Overexpression Lysate [NBP2-10543]](https://resources.bio-techne.com/images/products/HCC1-Overexpression-Lysate-Adult-Normal-Western-Blot-NBP2-10543-img0001.jpg "Western Blot: HCC1 Overexpression Lysate [NBP2-10543]")
| Reactivity: | Human |
| Details: | Rabbit IgG Polyclonal |
| Applications: | IHC, WB, IP |
| Reactivity: | Human |
| Details: | Rabbit IgG Polyclonal |
| Applications: | IHC, WB, IP |
| Reactivity: | Human |
| Details: | Rabbit IgG Polyclonal |
| Applications: | IHC, WB, IP |
| Chemical Name: | N1-(3-Chloro-1H-indol-7-yl)-1,4-benzenedisulfonamide |
| Purity: | ≥98% (HPLC) |
| Reactivity: | Human |
| Details: | Rabbit IgG Polyclonal |
| Applications: | IHC, IP |
Conjugate
Catalog #
Forumulation
Catalog #
| Reactivity: | Human |
| Details: | Rabbit IgG Polyclonal |
| Applications: | IHC, WB, IP |
Conjugate
Catalog #
Forumulation
Catalog #
| Reactivity: | Human |
| Details: | Rabbit IgG Polyclonal |
| Applications: | IHC, IP |
Conjugate
Catalog #
Forumulation
Catalog #
| Reactivity: | Human |
| Details: | Rabbit IgG Polyclonal |
| Applications: | IHC, WB, IP |
Conjugate
Catalog #
Forumulation
Catalog #
| Reactivity: | Human |
| Details: | Rabbit IgG Polyclonal |
| Applications: | IHC, IP |
Conjugate
Catalog #
Forumulation
Catalog #