40 results for "Ubiquitin Ligase (E3) Inhibitors" in Products
Ubiquitin Ligase (E3) Inhibitors Products
Ubiquitin E3 ligases (EC 6.3.2.19) attach ubiquitin molecules onto lysine residues of proteins in order to target the protein for a specific cellular process, such as proteasomal degradation or an alteration in subcellular localization. In addition to the specific ubiquitin ligases such as MDM2, E3A and anaphase-promoting complex (APC), many other proteins also contain domains that possess ubiquitin ligase activity. Almost all known ubiquitin E3 ligases contain one of three domains: a HECT, ...
MDM2 antagonist; active enantiomer of Nutlin-3 (Cat. No. 3984)
| Chemical Name: | 4-[[(4S,5R)-4,5-bis(4-Chlorophenyl)-4,5-dihydro-2-[4-methoxy-2-(1-methylethoxy)phenyl]-1H-imidazol-1-yl]carbonyl]-2-piperazinone |
| Purity: | ≥97% (HPLC) |
HECT E3 ubiquitin ligase inhibitor
| Chemical Name: | N-(4-Acetylphenyl)-3-(5-ethyl-2-furanyl)-2-propenamide |
| Purity: | ≥98% (HPLC) |
Cereblon binder; induces ubiquitination and degradation of CK1α by E3 ubiquitin ligase
| Chemical Name: | 3-(4-Amino-1,3-dihydro-1-oxo-2H-isoindol-2-yl)-2,6-piperidinedione |
| Purity: | ≥98% (HPLC) |
SPOP E3 ubiquitin ligase inhibitor
| Chemical Name: | 1,5-Dihydro-2-imino-10-methyl-N-[2-(4-methyl-1-piperazinyl)ethyl]-5-oxo-1-[2-(2-thienyl)ethyl]-2H-dipyrido[1,2-a:2',3'-d]pyrimidine-3-carboxamide |
| Purity: | ≥98% (HPLC) |
High-affinity inhibitor of VHL
| Chemical Name: | (2S,4R)-1-((S)-2-(1-cyanocyclopropanecarboxamido)-3,3-dimethylbutanoyl)-4-hydroxy-N-(4-(4-methylthiazol-5-yl)benzyl)pyrrolidine-2-carboxamide |
| Purity: | ≥98% (HPLC) |
MDM2-p53 interaction inhibitor
| Alternate Names: | NSC 652287 |
| Chemical Name: | 5,5'-(2,5-Furandiyl)bis-2-thiophenemethanol |
| Purity: | ≥97% (HPLC) |
(+)-JQ1 based Degrader (PROTAC®) that preferentially degrades BRD4
| Chemical Name: | (2S,4R)-1-((S)-2-(tert-butyl)-17-((S)-4-(4-chlorophenyl)-2,3,9-trimethyl-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepin-6-yl)-4,16-dioxo-6,9,12-trioxa-3,15-diazaheptadecanoyl)- 4-hydroxy-N-(4-(4-methylthiazol-5-yl)benzyl)pyrrolidine-2-carboxamide |
| Purity: | ≥98% (HPLC) |
Selective Skp2 inhibitor; suppresses E3 ligase activity
| Chemical Name: | 3-(2-Benzothiazolyl)-6-ethyl-7-hydroxy-8-(1-piperidinylmethyl)-4H-1-benzopyran-4-one |
| Purity: | ≥98% (HPLC) |
β-TrCP1 ligase inhibitor
| Chemical Name: | 4-[4-[[5-(2-Fluorophenyl)-2-furanyl]methylene]-4,5-dihydro-5-oxo-3-(phenylmethyl)-1H-pyrazol-1-yl]benzoic acid |
| Purity: | ≥98% (HPLC) |
Cdc20 inhibitor; inhibits Cdc20-substrate interaction
| Chemical Name: | 3-(2-Methyl-5-nitroimidazol-1-yl)-N-(2,2,2-trichloro-1-phenylaminoethyl)propionamide |
| Purity: | ≥98% (HPLC) |
Potent and selective CSN5 (COP9 signalosome) inhibitor
| Chemical Name: | 3-(Difluoromethyl)-N-(6-((5S,6S)-6-hydroxy-6,7,8,9-tetrahydro-5H-imidazo[1,5-a]azepin-5-yl)-[1,10-biphenyl]-3-yl)-1-isopropyl-1H-pyrazole-5-carboxamide |
| Purity: | ≥98% (HPLC) |
CHIP/STUB1 E3 ligase inhibitor
| Purity: | ≥95% (HPLC) |
MDM2 antagonist; inhibits MDM2-p53 interaction
| Chemical Name: | (±)-4-[4,5-Bis(4-chlorophenyl)-2-(2-isopropoxy-4-methoxy-phenyl)-4,5-dihydro-imidazole-1-carbonyl]-piperazin-2-one |
| Purity: | ≥98% (HPLC) |
Inhibitor of Bmi1/Ring1A; blocks histone H2A ubiquitination
| Chemical Name: | 2-(3-Pyridinylmethylene)-1H-Indene-1,3(2H)-dione |
| Purity: | ≥98% (HPLC) |
RNF114 inhibitor
| Chemical Name: | (2aR,5aR,6S,6aR,8R,9aR,10aS,10bR,10cR)-8-(3-Furanyl)-2a,5a,6,6a,8,9,9a,10a,10b,10c-decahydro-2a,5a,6a,7-tetramethyl-2,5-dioxo-2H,5H-cyclopenta[d']naphtho[1,8-bc:2,3-b']difuran-6-acetic acid methyl ester |
| Purity: | ≥97% (HPLC) |
Potent, selective and reversible DCN1-UBC12 interaction inhibitor
| Chemical Name: | 5-[[2-[[(4-Chlorophenyl)methyl]thio]-5-methyl[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]thio]-N,N-dimethyl-1H-tetrazole-1-ethanamine hydrochloride |
| Purity: | ≥98% (HPLC) |
(+)-JQ1 based Degrader (PROTAC®) targeting BET bromodomains, active in vivo
| Chemical Name: | (6S)-4-(4-Chlorophenyl)-N-[4-[[2-[[2-(2,6-dioxo-3-piperidinyl)-2,3-dihydro-1,3-dioxo-1H-isoindol-4-yl]oxy]acetyl]amino]butyl]-2,3,9-trimethyl-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepine-6-acetamide |
| Purity: | ≥98% (HPLC) |
Homo-PROTAC® for self-degradation of pVHL30
| Chemical Name: | N1,N20-bis((S)-1-((2S,4R)-4-Hydroxy-2-((4-(4-methylthiazol-5-yl)benzyl)carbamoyl)pyrrolidin-1-yl)-3,3-dimethyl-1-oxobutan-2-yl)-3,6,9,12,15,18-hexaoxaicosanediamide |
| Purity: | ≥98% (HPLC) |
Molecular glue; pre-mRNA splicing modulator
| Chemical Name: | N1-(3-Chloro-1H-indol-7-yl)-1,4-benzenedisulfonamide |
| Purity: | ≥98% (HPLC) |
Cereblon binder; also TNF-α inhibitor and antiangiogenic
| Chemical Name: | 4-Amino-2-(2,6-dioxo-3-piperidinyl)-1H-isoindole-1,3(2H)-dione |
| Purity: | ≥98% (HPLC) |
SKP2 (S-phase kinase-associated protein 2) inhibitor; upregulates p27 and arrests cell cycle in G1 phase
| Chemical Name: | N-(4-Butyl-2-methylphenyl)acetamide |
| Purity: | ≥98% (HPLC) |
Hdm2 inhibitor; activates p53-dependent transcription
| Chemical Name: | 5-[[3-Dimethylamino)propyl]amino]-3,10-dimethylpyrimido[4,5-b]quinoline-2,4(3H,10H)-dione dihydrochloride |
| Purity: | ≥98% (HPLC) |
High affinity MDM2 inhibitor
| Chemical Name: | 6-Methoxy-1-(1-naphthalenyl)-9H-pyrido[3,4-b]indole |
| Purity: | ≥98% (HPLC) |
MAGE-A11 inhibitor; disrupts MAGE-A11:PCF11 interaction
| Chemical Name: | N1-((1H-Indol-5-yl)methyl)-N3-(quinolin-4-yl)propane-1,3-diamine |
| Purity: | ≥98% (HPLC) |
Inhibitor of VHL; blocks interaction of VHL and HIF-α
| Chemical Name: | (2S,4R)-1-((S)-2-Acetamido-3,3-dimethylbutanoyl)-4-hydroxy-N-(4-(4-methylthiazol-5-yl)benzyl)pyrrolidine-2-carboxamide |
| Purity: | ≥98% (HPLC) |
